C12H22F2N2O — CID 100701582
2,2-difluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]butyl]acetamide (PubChem CID 100701582) has the molecular formula C12H22F2N2O and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,2-difluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]butyl]acetamide.
| Compound Name | 2,2-difluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]butyl]acetamide |
|---|---|
| PubChem CID | 100701582 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2,2-difluoro-N-[4-[(3S)-3-methylpiperidin-1-yl]butyl]acetamide |
| SMILES | C[C@H]1CCCN(CCCCNC(=O)C(F)F)C1 |
| InChI | InChI=1S/C12H22F2N2O/c1-10-5-4-8-16(9-10)7-3-2-6-15-12(17)11(13)14/h10-11H,2-9H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | PPEFBDSNTQYAKD-JTQLQIEISA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|