C18H36N4 — CID 111143864
N',3-dimethyl-N-[4-(3-methylpiperidin-1-yl)butyl]piperidine-1-carboximidamide (PubChem CID 111143864) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is N',3-dimethyl-N-[4-(3-methylpiperidin-1-yl)butyl]piperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-[4-(3-methylpiperidin-1-yl)butyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111143864 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | N',3-dimethyl-N-[4-(3-methylpiperidin-1-yl)butyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCCC(C)C1)N1CCCC(C)C1 |
| InChI | InChI=1S/C18H36N4/c1-16-8-6-12-21(14-16)11-5-4-10-20-18(19-3)22-13-7-9-17(2)15-22/h16-17H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | QBDVIKALWNGJRH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|