C20H32N4 — CID 110983752
N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 110983752) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110983752 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | N'-methyl-N-[4-(3-methylpiperidin-1-yl)butyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCCC(C)C1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H32N4/c1-17-8-7-14-23(16-17)13-6-5-12-22-20(21-2)24-15-11-18-9-3-4-10-19(18)24/h3-4,9-10,17H,5-8,11-16H2,1-2H3,(H,21,22) |
| InChIKey | XLKBWRFDAFOHET-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|