C15H23N3 — CID 110984242
N'-methyl-N-pentyl-2,3-dihydroindole-1-carboximidamide (PubChem CID 110984242) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N'-methyl-N-pentyl-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-methyl-N-pentyl-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110984242 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N'-methyl-N-pentyl-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCCCCN/C(=N\C)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H23N3/c1-3-4-7-11-17-15(16-2)18-12-10-13-8-5-6-9-14(13)18/h5-6,8-9H,3-4,7,10-12H2,1-2H3,(H,16,17) |
| InChIKey | UJDUIXRUXPNELD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|