C15H25IN4O2S — CID 110984215
N-[3-(ethylsulfonylamino)propyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110984215) has the molecular formula C15H25IN4O2S and a molecular weight of 452.36 g/mol. Its IUPAC name is N-[3-(ethylsulfonylamino)propyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(ethylsulfonylamino)propyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110984215 |
| Molecular Formula | C15H25IN4O2S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[3-(ethylsulfonylamino)propyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)N1CCc2ccccc21.I |
| InChI | InChI=1S/C15H24N4O2S.HI/c1-3-22(20,21)18-11-6-10-17-15(16-2)19-12-9-13-7-4-5-8-14(13)19;/h4-5,7-8,18H,3,6,9-12H2,1-2H3,(H,16,17);1H |
| InChIKey | UHHWMVPPCJNANH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|