C18H22ClIN4O2S — CID 110983775
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110983775) has the molecular formula C18H22ClIN4O2S and a molecular weight of 520.82 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110983775 |
| Molecular Formula | C18H22ClIN4O2S |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccc(Cl)c1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C18H21ClN4O2S.HI/c1-20-18(23-12-9-14-5-2-3-8-17(14)23)21-10-11-22-26(24,25)16-7-4-6-15(19)13-16;/h2-8,13,22H,9-12H2,1H3,(H,20,21);1H |
| InChIKey | VQKVNGKFEWGAPE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|