C18H27ClN4O2S — CID 109442581
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442581) has the molecular formula C18H27ClN4O2S and a molecular weight of 398.96 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442581 |
| Molecular Formula | C18H27ClN4O2S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccc(Cl)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C18H27ClN4O2S/c1-20-18(23-12-14-5-2-3-6-15(14)13-23)21-9-10-22-26(24,25)17-8-4-7-16(19)11-17/h4,7-8,11,14-15,22H,2-3,5-6,9-10,12-13H2,1H3,(H,20,21) |
| InChIKey | JDBBXLKBMRBXFW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|