C17H21ClN4O2S — CID 110952824
1-benzyl-3-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methylguanidine (PubChem CID 110952824) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 1-benzyl-3-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methylguanidine.
| Compound Name | 1-benzyl-3-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110952824 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-benzyl-3-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc(Cl)c1)NCc1ccccc1 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-19-17(21-13-14-6-3-2-4-7-14)20-10-11-22-25(23,24)16-9-5-8-15(18)12-16/h2-9,12,22H,10-11,13H2,1H3,(H2,19,20,21) |
| InChIKey | RGGDSRJVFVQJKM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|