C16H22ClIN4O2S2 — CID 111897264
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111897264) has the molecular formula C16H22ClIN4O2S2 and a molecular weight of 528.87 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111897264 |
| Molecular Formula | C16H22ClIN4O2S2 |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 527.99 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc(Cl)c1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C16H21ClN4O2S2.HI/c1-12-6-7-14(24-12)11-20-16(18-2)19-8-9-21-25(22,23)15-5-3-4-13(17)10-15;/h3-7,10,21H,8-9,11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JGEGECIPSRSZLG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|