C17H28ClIN4O3S — CID 111391738
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111391738) has the molecular formula C17H28ClIN4O3S and a molecular weight of 530.86 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111391738 |
| Molecular Formula | C17H28ClIN4O3S |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-[3-(cyclopropylmethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CC1)NCCNS(=O)(=O)c1cccc(Cl)c1.I |
| InChI | InChI=1S/C17H27ClN4O3S.HI/c1-19-17(20-8-3-11-25-13-14-6-7-14)21-9-10-22-26(23,24)16-5-2-4-15(18)12-16;/h2,4-5,12,14,22H,3,6-11,13H2,1H3,(H2,19,20,21);1H |
| InChIKey | CGPCFSJOOCHMIA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|