C16H26ClIN4O2S — CID 110957505
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide (PubChem CID 110957505) has the molecular formula C16H26ClIN4O2S and a molecular weight of 500.83 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110957505 |
| Molecular Formula | C16H26ClIN4O2S |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-cyclohexyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccc(Cl)c1)NC1CCCCC1.I |
| InChI | InChI=1S/C16H25ClN4O2S.HI/c1-18-16(21-14-7-3-2-4-8-14)19-10-11-20-24(22,23)15-9-5-6-13(17)12-15;/h5-6,9,12,14,20H,2-4,7-8,10-11H2,1H3,(H2,18,19,21);1H |
| InChIKey | SQDNUQHPOQXQFY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|