C16H25ClN4O2S — CID 111210097
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N',4-dimethylpiperidine-1-carboximidamide (PubChem CID 111210097) has the molecular formula C16H25ClN4O2S and a molecular weight of 372.92 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N',4-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N',4-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111210097 |
| Molecular Formula | C16H25ClN4O2S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N',4-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc(Cl)c1)N1CCC(C)CC1 |
| InChI | InChI=1S/C16H25ClN4O2S/c1-13-6-10-21(11-7-13)16(18-2)19-8-9-20-24(22,23)15-5-3-4-14(17)12-15/h3-5,12-13,20H,6-11H2,1-2H3,(H,18,19) |
| InChIKey | BMXDZILWIHTRGT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|