C11H25IN4O2S — CID 119130831
N-[2-(methanesulfonamido)ethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119130831) has the molecular formula C11H25IN4O2S and a molecular weight of 404.32 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130831 |
| Molecular Formula | C11H25IN4O2S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-N',4-dimethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)N1CCC(C)CC1.I |
| InChI | InChI=1S/C11H24N4O2S.HI/c1-10-4-8-15(9-5-10)11(12-2)13-6-7-14-18(3,16)17;/h10,14H,4-9H2,1-3H3,(H,12,13);1H |
| InChIKey | LWPPCZMHRPNEEY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|