C16H24ClF3IN5O2S — CID 111914279
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111914279) has the molecular formula C16H24ClF3IN5O2S and a molecular weight of 569.82 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111914279 |
| Molecular Formula | C16H24ClF3IN5O2S |
| Molecular Weight | 569.82 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(=O)(=O)c1cccc(Cl)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C16H23ClF3N5O2S.HI/c1-21-15(24-13-5-8-25(10-13)11-16(18,19)20)22-6-7-23-28(26,27)14-4-2-3-12(17)9-14;/h2-4,9,13,23H,5-8,10-11H2,1H3,(H2,21,22,24);1H |
| InChIKey | KIAGYFQUJJFDGQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|