C16H22ClF3N4 — CID 111196874
1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111196874) has the molecular formula C16H22ClF3N4 and a molecular weight of 362.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111196874 |
| Molecular Formula | C16H22ClF3N4 |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(Cl)cc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H22ClF3N4/c1-21-15(22-8-6-12-2-4-13(17)5-3-12)23-14-7-9-24(10-14)11-16(18,19)20/h2-5,14H,6-11H2,1H3,(H2,21,22,23) |
| InChIKey | ZKQIKAYTUBMRCQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|