C15H20Cl2F3IN4 — CID 111198023
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111198023) has the molecular formula C15H20Cl2F3IN4 and a molecular weight of 511.16 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111198023 |
| Molecular Formula | C15H20Cl2F3IN4 |
| Molecular Weight | 511.16 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1Cl)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C15H19Cl2F3N4.HI/c1-21-14(22-7-10-2-3-11(16)6-13(10)17)23-12-4-5-24(8-12)9-15(18,19)20;/h2-3,6,12H,4-5,7-9H2,1H3,(H2,21,22,23);1H |
| InChIKey | NFCLPNKUKKIVFK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|