C14H22F3IN4S — CID 111898848
2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111898848) has the molecular formula C14H22F3IN4S and a molecular weight of 462.32 g/mol. Its IUPAC name is 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111898848 |
| Molecular Formula | C14H22F3IN4S |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)s1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C14H21F3N4S.HI/c1-10-3-4-12(22-10)7-19-13(18-2)20-11-5-6-21(8-11)9-14(15,16)17;/h3-4,11H,5-9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | NVRIVRVZOGPNAQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|