C18H28F3IN4O3 — CID 111368140
2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111368140) has the molecular formula C18H28F3IN4O3 and a molecular weight of 532.35 g/mol. Its IUPAC name is 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111368140 |
| Molecular Formula | C18H28F3IN4O3 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-[(2,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(OC)c(OC)cc1OC)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H27F3N4O3.HI/c1-22-17(24-13-5-6-25(10-13)11-18(19,20)21)23-9-12-7-15(27-3)16(28-4)8-14(12)26-2;/h7-8,13H,5-6,9-11H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | ZZTPEUFKYPYBRS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|