C18H25F6IN4O2 — CID 111915876
1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915876) has the molecular formula C18H25F6IN4O2 and a molecular weight of 570.32 g/mol. Its IUPAC name is 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915876 |
| Molecular Formula | C18H25F6IN4O2 |
| Molecular Weight | 570.32 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | 1-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)c(OC)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H24F6N4O2.HI/c1-25-16(27-13-5-6-28(9-13)10-17(19,20)21)26-8-12-3-4-14(15(7-12)29-2)30-11-18(22,23)24;/h3-4,7,13H,5-6,8-11H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | ZMOKISRVXZUQNQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|