C20H32F3IN4O2 — CID 111246142
1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111246142) has the molecular formula C20H32F3IN4O2 and a molecular weight of 544.40 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111246142 |
| Molecular Formula | C20H32F3IN4O2 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N\C)NC2CCN(CC(F)(F)F)C2)cc1OCC.I |
| InChI | InChI=1S/C20H31F3N4O2.HI/c1-4-28-17-7-6-15(12-18(17)29-5-2)8-10-25-19(24-3)26-16-9-11-27(13-16)14-20(21,22)23;/h6-7,12,16H,4-5,8-11,13-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | OMRMOTMROVKJLI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|