C16H22ClF4IN4 — CID 111578030
1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111578030) has the molecular formula C16H22ClF4IN4 and a molecular weight of 508.73 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111578030 |
| Molecular Formula | C16H22ClF4IN4 |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1Cl)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C16H21ClF4N4.HI/c1-22-15(23-6-4-11-2-3-12(18)8-14(11)17)24-13-5-7-25(9-13)10-16(19,20)21;/h2-3,8,13H,4-7,9-10H2,1H3,(H2,22,23,24);1H |
| InChIKey | XYQIDPOXXHLWFM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|