C14H19ClFN3O2S — CID 111827697
1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111827697) has the molecular formula C14H19ClFN3O2S and a molecular weight of 347.84 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111827697 |
| Molecular Formula | C14H19ClFN3O2S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19ClFN3O2S/c1-17-14(19-12-5-7-22(20,21)9-12)18-6-4-10-2-3-11(16)8-13(10)15/h2-3,8,12H,4-7,9H2,1H3,(H2,17,18,19) |
| InChIKey | NMMKAZLOFGYECV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|