C15H21ClFN3O2S — CID 111827735
2-[2-(2-chloro-4-fluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111827735) has the molecular formula C15H21ClFN3O2S and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111827735 |
| Molecular Formula | C15H21ClFN3O2S |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CCc1ccc(F)cc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21ClFN3O2S/c1-2-18-15(20-13-6-8-23(21,22)10-13)19-7-5-11-3-4-12(17)9-14(11)16/h3-4,9,13H,2,5-8,10H2,1H3,(H2,18,19,20) |
| InChIKey | BPXOIQLAWLBKMF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|