C15H24N4O2S — CID 109401195
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109401195) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109401195 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccncc1C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H24N4O2S/c1-3-17-15(19-14-6-9-22(20,21)11-14)18-8-5-13-4-7-16-10-12(13)2/h4,7,10,14H,3,5-6,8-9,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | QSOXYXWRCPFHLZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|