C15H22F2IN3O2S — CID 111780940
2-[2-(2,4-difluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111780940) has the molecular formula C15H22F2IN3O2S and a molecular weight of 473.33 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111780940 |
| Molecular Formula | C15H22F2IN3O2S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)ethyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(F)cc1F)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H21F2N3O2S.HI/c1-2-18-15(20-13-6-8-23(21,22)10-13)19-7-5-11-3-4-12(16)9-14(11)17;/h3-4,9,13H,2,5-8,10H2,1H3,(H2,18,19,20);1H |
| InChIKey | VPFXENXMUOEWEK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|