C14H20BrFIN3O2S — CID 111141950
2-[(4-bromo-3-fluorophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111141950) has the molecular formula C14H20BrFIN3O2S and a molecular weight of 520.21 g/mol. Its IUPAC name is 2-[(4-bromo-3-fluorophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141950 |
| Molecular Formula | C14H20BrFIN3O2S |
| Molecular Weight | 520.21 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)c(F)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H19BrFN3O2S.HI/c1-2-17-14(19-11-5-6-22(20,21)9-11)18-8-10-3-4-12(15)13(16)7-10;/h3-4,7,11H,2,5-6,8-9H2,1H3,(H2,17,18,19);1H |
| InChIKey | SYVXKBDVHQYFMI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|