C18H28BrFIN3OS — CID 109438720
2-[(4-bromo-3-fluorophenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109438720) has the molecular formula C18H28BrFIN3OS and a molecular weight of 560.32 g/mol. Its IUPAC name is 2-[(4-bromo-3-fluorophenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109438720 |
| Molecular Formula | C18H28BrFIN3OS |
| Molecular Weight | 560.32 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | 2-[(4-bromo-3-fluorophenyl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)c(F)c1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C18H27BrFN3OS.HI/c1-3-21-18(22-12-13-8-9-16(19)17(20)10-13)23-14-6-5-7-15(11-14)25(24)4-2;/h8-10,14-15H,3-7,11-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | LHMKXGBVLKITCI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|