C23H41IN4OS — CID 109440384
2-[[4-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109440384) has the molecular formula C23H41IN4OS and a molecular weight of 548.58 g/mol. Its IUPAC name is 2-[[4-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440384 |
| Molecular Formula | C23H41IN4OS |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2-[[4-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN(CC)CC)cc1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C23H40N4OS.HI/c1-5-24-23(26-21-10-9-11-22(16-21)29(28)8-4)25-17-19-12-14-20(15-13-19)18-27(6-2)7-3;/h12-15,21-22H,5-11,16-18H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | GQZFLVVOBSGXFE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|