C22H37IN4OS — CID 109439362
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide (PubChem CID 109439362) has the molecular formula C22H37IN4OS and a molecular weight of 532.54 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439362 |
| Molecular Formula | C22H37IN4OS |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)CCCN2C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C22H36N4OS.HI/c1-4-23-22(25-19-9-6-10-20(15-19)28(27)5-2)24-16-17-11-12-21-18(14-17)8-7-13-26(21)3;/h11-12,14,19-20H,4-10,13,15-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QGVPAHAQCHLDPE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|