C17H23FIN5O2S — CID 111142810
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111142810) has the molecular formula C17H23FIN5O2S and a molecular weight of 507.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142810 |
| Molecular Formula | C17H23FIN5O2S |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H22FN5O2S.HI/c1-2-20-17(22-14-5-8-26(24,25)11-14)21-10-13-3-4-16(15(18)9-13)23-7-6-19-12-23;/h3-4,6-7,9,12,14H,2,5,8,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | JQJRJWZYEQAHMJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|