C20H29FN6 — CID 111261217
1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine (PubChem CID 111261217) has the molecular formula C20H29FN6 and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111261217 |
| Molecular Formula | C20H29FN6 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NCC1CCCN1CC |
| InChI | InChI=1S/C20H29FN6/c1-3-23-20(25-14-17-6-5-10-26(17)4-2)24-13-16-7-8-19(18(21)12-16)27-11-9-22-15-27/h7-9,11-12,15,17H,3-6,10,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | RXBAZHZFOIFSAC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|