C19H23FN6S — CID 111535010
1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine (PubChem CID 111535010) has the molecular formula C19H23FN6S and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111535010 |
| Molecular Formula | C19H23FN6S |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NCc1ncc(CC)s1 |
| InChI | InChI=1S/C19H23FN6S/c1-3-15-11-23-18(27-15)12-25-19(22-4-2)24-10-14-5-6-17(16(20)9-14)26-8-7-21-13-26/h5-9,11,13H,3-4,10,12H2,1-2H3,(H2,22,24,25) |
| InChIKey | XQWUDYXSHVJIHK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|