C19H21ClFN5OS — CID 111702327
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine (PubChem CID 111702327) has the molecular formula C19H21ClFN5OS and a molecular weight of 421.93 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111702327 |
| Molecular Formula | C19H21ClFN5OS |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H21ClFN5OS/c1-2-23-19(25-11-16(27)17-5-6-18(20)28-17)24-10-13-3-4-15(14(21)9-13)26-8-7-22-12-26/h3-9,12,16,27H,2,10-11H2,1H3,(H2,23,24,25) |
| InChIKey | FFWJPNNFQCEOFJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|