C23H30FIN6S — CID 111011458
1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111011458) has the molecular formula C23H30FIN6S and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011458 |
| Molecular Formula | C23H30FIN6S |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2)c(F)c1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C23H29FN6S.HI/c1-2-26-23(28-16-21(22-6-5-13-31-22)29-10-3-4-11-29)27-15-18-7-8-20(19(24)14-18)30-12-9-25-17-30;/h5-9,12-14,17,21H,2-4,10-11,15-16H2,1H3,(H2,26,27,28);1H |
| InChIKey | LIYGMZDETFMRNM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|