C22H28FIN6S — CID 111011456
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111011456) has the molecular formula C22H28FIN6S and a molecular weight of 554.48 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011456 |
| Molecular Formula | C22H28FIN6S |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C22H27FN6S.HI/c1-24-22(27-15-20(21-5-4-12-30-21)28-9-2-3-10-28)26-14-17-6-7-19(18(23)13-17)29-11-8-25-16-29;/h4-8,11-13,16,20H,2-3,9-10,14-15H2,1H3,(H2,24,26,27);1H |
| InChIKey | IOYFELZDFFHAGJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|