C21H32FIN6 — CID 111321381
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111321381) has the molecular formula C21H32FIN6 and a molecular weight of 514.43 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111321381 |
| Molecular Formula | C21H32FIN6 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)NCC(C)(C)N1CCCCC1.I |
| InChI | InChI=1S/C21H31FN6.HI/c1-21(2,28-10-5-4-6-11-28)15-26-20(23-3)25-14-17-7-8-19(18(22)13-17)27-12-9-24-16-27;/h7-9,12-13,16H,4-6,10-11,14-15H2,1-3H3,(H2,23,25,26);1H |
| InChIKey | CYTICUPRSCGNJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|