C18H22FIN6O — CID 109430870
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109430870) has the molecular formula C18H22FIN6O and a molecular weight of 484.32 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109430870 |
| Molecular Formula | C18H22FIN6O |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C18H21FN6O.HI/c1-12-13(2)26-17(24-12)10-23-18(20-3)22-9-14-4-5-16(15(19)8-14)25-7-6-21-11-25;/h4-8,11H,9-10H2,1-3H3,(H2,20,22,23);1H |
| InChIKey | PYFDWDQBRWGWHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|