C15H18ClFN4O — CID 109431227
1-[(3-chloro-4-fluorophenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine (PubChem CID 109431227) has the molecular formula C15H18ClFN4O and a molecular weight of 324.79 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109431227 |
| Molecular Formula | C15H18ClFN4O |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(F)c(Cl)c1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C15H18ClFN4O/c1-9-10(2)22-14(21-9)8-20-15(18-3)19-7-11-4-5-13(17)12(16)6-11/h4-6H,7-8H2,1-3H3,(H2,18,19,20) |
| InChIKey | MSLZMSGQNOXLGK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|