C17H20FN7 — CID 111956087
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111956087) has the molecular formula C17H20FN7 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111956087 |
| Molecular Formula | C17H20FN7 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)NCc1ccnn1C |
| InChI | InChI=1S/C17H20FN7/c1-19-17(22-11-14-5-6-23-24(14)2)21-10-13-3-4-16(15(18)9-13)25-8-7-20-12-25/h3-9,12H,10-11H2,1-2H3,(H2,19,21,22) |
| InChIKey | COUOZTXMBHITGT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|