C18H21FN6S — CID 111534630
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine (PubChem CID 111534630) has the molecular formula C18H21FN6S and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111534630 |
| Molecular Formula | C18H21FN6S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCc2ccc(-n3ccnc3)c(F)c2)s1 |
| InChI | InChI=1S/C18H21FN6S/c1-3-14-10-22-17(26-14)11-24-18(20-2)23-9-13-4-5-16(15(19)8-13)25-7-6-21-12-25/h4-8,10,12H,3,9,11H2,1-2H3,(H2,20,23,24) |
| InChIKey | LSCSHBIXMLMTGQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|