C23H24FN7 — CID 111850936
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111850936) has the molecular formula C23H24FN7 and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111850936 |
| Molecular Formula | C23H24FN7 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2ccnc2)c(F)c1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C23H24FN7/c1-25-23(27-14-18-7-8-22(21(24)13-18)30-12-10-26-17-30)28-15-19-5-2-3-6-20(19)16-31-11-4-9-29-31/h2-13,17H,14-16H2,1H3,(H2,25,27,28) |
| InChIKey | OCDOACVKJBDAGX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|