C20H22ClFIN5 — CID 111358313
1-[2-(3-chlorophenyl)ethyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111358313) has the molecular formula C20H22ClFIN5 and a molecular weight of 513.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111358313 |
| Molecular Formula | C20H22ClFIN5 |
| Molecular Weight | 513.79 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1ccc(-n2ccnc2)c(F)c1.I |
| InChI | InChI=1S/C20H21ClFN5.HI/c1-23-20(25-8-7-15-3-2-4-17(21)11-15)26-13-16-5-6-19(18(22)12-16)27-10-9-24-14-27;/h2-6,9-12,14H,7-8,13H2,1H3,(H2,23,25,26);1H |
| InChIKey | JSUDZXPWGPRMMM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.79 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|