C18H19F4IN6S — CID 111687683
1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111687683) has the molecular formula C18H19F4IN6S and a molecular weight of 554.36 g/mol. Its IUPAC name is 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687683 |
| Molecular Formula | C18H19F4IN6S |
| Molecular Weight | 554.36 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | 1-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1ccc(-n2ccnc2)c(F)c1.I |
| InChI | InChI=1S/C18H18F4N6S.HI/c1-23-17(25-5-4-16-27-15(10-29-16)18(20,21)22)26-9-12-2-3-14(13(19)8-12)28-7-6-24-11-28;/h2-3,6-8,10-11H,4-5,9H2,1H3,(H2,23,25,26);1H |
| InChIKey | QADSSJFNXFMNOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|