C15H16BrF4IN4S — CID 111688675
1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688675) has the molecular formula C15H16BrF4IN4S and a molecular weight of 567.19 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688675 |
| Molecular Formula | C15H16BrF4IN4S |
| Molecular Weight | 567.19 g/mol |
| Exact Mass | 565.93 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(C(F)(F)F)cs1)NCc1ccc(Br)c(F)c1.I |
| InChI | InChI=1S/C15H15BrF4N4S.HI/c1-21-14(23-7-9-2-3-10(16)11(17)6-9)22-5-4-13-24-12(8-25-13)15(18,19)20;/h2-3,6,8H,4-5,7H2,1H3,(H2,21,22,23);1H |
| InChIKey | SNSWERVCYJHXQZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|