C20H27F3IN5OS — CID 111689361
N,N-diethyl-4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111689361) has the molecular formula C20H27F3IN5OS and a molecular weight of 569.44 g/mol. Its IUPAC name is N,N-diethyl-4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-diethyl-4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111689361 |
| Molecular Formula | C20H27F3IN5OS |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | N,N-diethyl-4-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)cc1.I |
| InChI | InChI=1S/C20H26F3N5OS.HI/c1-4-28(5-2)18(29)15-8-6-14(7-9-15)12-26-19(24-3)25-11-10-17-27-16(13-30-17)20(21,22)23;/h6-9,13H,4-5,10-12H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | ANENTYNJOKJPFV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|