C17H20F3N5OS — CID 111616692
N,N-dimethyl-4-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111616692) has the molecular formula C17H20F3N5OS and a molecular weight of 399.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111616692 |
| Molecular Formula | C17H20F3N5OS |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N(C)C)cc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H20F3N5OS/c1-21-16(23-9-14-24-13(10-27-14)17(18,19)20)22-8-11-4-6-12(7-5-11)15(26)25(2)3/h4-7,10H,8-9H2,1-3H3,(H2,21,22,23) |
| InChIKey | BSCHBZQTILBZLL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|