C17H20F3N5OS — CID 111615643
N-ethyl-3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111615643) has the molecular formula C17H20F3N5OS and a molecular weight of 399.44 g/mol. Its IUPAC name is N-ethyl-3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111615643 |
| Molecular Formula | C17H20F3N5OS |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-ethyl-3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N/C)NCc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C17H20F3N5OS/c1-3-22-15(26)12-6-4-5-11(7-12)8-23-16(21-2)24-9-14-25-13(10-27-14)17(18,19)20/h4-7,10H,3,8-9H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | HBZQVLBAHRZKAK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|