C16H19F3IN5OS — CID 111615199
N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111615199) has the molecular formula C16H19F3IN5OS and a molecular weight of 513.33 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111615199 |
| Molecular Formula | C16H19F3IN5OS |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(C)=O)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H18F3N5OS.HI/c1-10(25)23-12-5-3-4-11(6-12)7-21-15(20-2)22-8-14-24-13(9-26-14)16(17,18)19;/h3-6,9H,7-8H2,1-2H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | KTJMGPUMIXYRCM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|