C20H26F3N5OS — CID 111688044
2-methyl-N-[3-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 111688044) has the molecular formula C20H26F3N5OS and a molecular weight of 441.52 g/mol. Its IUPAC name is 2-methyl-N-[3-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | 2-methyl-N-[3-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111688044 |
| Molecular Formula | C20H26F3N5OS |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-methyl-N-[3-[[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)c1 |
| InChI | InChI=1S/C20H26F3N5OS/c1-4-13(2)18(29)27-15-7-5-6-14(10-15)11-26-19(24-3)25-9-8-17-28-16(12-30-17)20(21,22)23/h5-7,10,12-13H,4,8-9,11H2,1-3H3,(H,27,29)(H2,24,25,26) |
| InChIKey | IGSLVVZSIGKUNW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|