C18H23F3IN5OS — CID 111689291
N-(3-ethylphenyl)-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111689291) has the molecular formula C18H23F3IN5OS and a molecular weight of 541.38 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(3-ethylphenyl)-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111689291 |
| Molecular Formula | C18H23F3IN5OS |
| Molecular Weight | 541.38 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | N-(3-ethylphenyl)-2-[[N'-methyl-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCc1cccc(NC(=O)CN/C(=N/C)NCCc2nc(C(F)(F)F)cs2)c1.I |
| InChI | InChI=1S/C18H22F3N5OS.HI/c1-3-12-5-4-6-13(9-12)25-15(27)10-24-17(22-2)23-8-7-16-26-14(11-28-16)18(19,20)21;/h4-6,9,11H,3,7-8,10H2,1-2H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | VHPIIMKLAYSKLE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|